C13H17F2N2O+ — CID 7285657
(2,6-difluorophenyl)-(4-ethylpiperazin-4-ium-1-yl)methanone (PubChem CID 7285657) has the molecular formula C13H17F2N2O+ and a molecular weight of 255.29 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(4-ethylpiperazin-4-ium-1-yl)methanone.
| Compound Name | (2,6-difluorophenyl)-(4-ethylpiperazin-4-ium-1-yl)methanone |
|---|---|
| PubChem CID | 7285657 |
| Molecular Formula | C13H17F2N2O+ |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (2,6-difluorophenyl)-(4-ethylpiperazin-4-ium-1-yl)methanone |
| SMILES | CC[NH+]1CCN(C(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C13H16F2N2O/c1-2-16-6-8-17(9-7-16)13(18)12-10(14)4-3-5-11(12)15/h3-5H,2,6-9H2,1H3/p+1 |
| InChIKey | ONVYGJQFWSUQBW-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |