C14H18F2N2O — CID 54923672
(2,6-difluorophenyl)-[4-(ethylamino)piperidin-1-yl]methanone (PubChem CID 54923672) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is (2,6-difluorophenyl)-[4-(ethylamino)piperidin-1-yl]methanone.
| Compound Name | (2,6-difluorophenyl)-[4-(ethylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 54923672 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (2,6-difluorophenyl)-[4-(ethylamino)piperidin-1-yl]methanone |
| SMILES | CCNC1CCN(C(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C14H18F2N2O/c1-2-17-10-6-8-18(9-7-10)14(19)13-11(15)4-3-5-12(13)16/h3-5,10,17H,2,6-9H2,1H3 |
| InChIKey | PCGAKCIQQNFLFW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |