C16H21FN6O3S2 — CID 91153496
O-methyl N-[[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]-(2H-triazol-4-yl)methyl]carbamothioate (PubChem CID 91153496) has the molecular formula C16H21FN6O3S2 and a molecular weight of 428.52 g/mol. Its IUPAC name is O-methyl N-[[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]-(2H-triazol-4-yl)methyl]carbamothioate.
| Compound Name | O-methyl N-[[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]-(2H-triazol-4-yl)methyl]carbamothioate |
|---|---|
| PubChem CID | 91153496 |
| Molecular Formula | C16H21FN6O3S2 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | O-methyl N-[[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]-(2H-triazol-4-yl)methyl]carbamothioate |
| SMILES | COC(=S)NC(c1ccc(N2CCN(S(C)(=O)=O)CC2)c(F)c1)c1cn[nH]n1 |
| InChI | InChI=1S/C16H21FN6O3S2/c1-26-16(27)19-15(13-10-18-21-20-13)11-3-4-14(12(17)9-11)22-5-7-23(8-6-22)28(2,24)25/h3-4,9-10,15H,5-8H2,1-2H3,(H,19,27)(H,18,20,21) |
| InChIKey | QUWYQNSOGISQOA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|