C13H11BrF3NO2 — CID 106857562
1-(2-bromofuran-3-yl)-N-methyl-1-[3-(trifluoromethoxy)phenyl]methanamine (PubChem CID 106857562) has the molecular formula C13H11BrF3NO2 and a molecular weight of 350.13 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-N-methyl-1-[3-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | 1-(2-bromofuran-3-yl)-N-methyl-1-[3-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 106857562 |
| Molecular Formula | C13H11BrF3NO2 |
| Molecular Weight | 350.13 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-N-methyl-1-[3-(trifluoromethoxy)phenyl]methanamine |
| SMILES | CNC(c1cccc(OC(F)(F)F)c1)c1ccoc1Br |
| InChI | InChI=1S/C13H11BrF3NO2/c1-18-11(10-5-6-19-12(10)14)8-3-2-4-9(7-8)20-13(15,16)17/h2-7,11,18H,1H3 |
| InChIKey | VWGGBVZDNJOTHN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.13 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |