C14H13BrF3NO2 — CID 115854117
N-[(5-bromofuran-2-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine (PubChem CID 115854117) has the molecular formula C14H13BrF3NO2 and a molecular weight of 364.16 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[(5-bromofuran-2-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 115854117 |
| Molecular Formula | C14H13BrF3NO2 |
| Molecular Weight | 364.16 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | N-[(5-bromofuran-2-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine |
| SMILES | CCNC(c1cccc(OC(F)(F)F)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C14H13BrF3NO2/c1-2-19-13(11-6-7-12(15)20-11)9-4-3-5-10(8-9)21-14(16,17)18/h3-8,13,19H,2H2,1H3 |
| InChIKey | UTMRZRHMJNLFRD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.16 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |