C13H12Br2ClNO — CID 81291306
N-[(4-bromo-3-chlorophenyl)-(5-bromofuran-2-yl)methyl]ethanamine (PubChem CID 81291306) has the molecular formula C13H12Br2ClNO and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[(4-bromo-3-chlorophenyl)-(5-bromofuran-2-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-3-chlorophenyl)-(5-bromofuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81291306 |
| Molecular Formula | C13H12Br2ClNO |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 390.90 |
| IUPAC Name | N-[(4-bromo-3-chlorophenyl)-(5-bromofuran-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)c(Cl)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H12Br2ClNO/c1-2-17-13(11-5-6-12(15)18-11)8-3-4-9(14)10(16)7-8/h3-7,13,17H,2H2,1H3 |
| InChIKey | ZUQBMEYRLLHXLY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |