C14H13ClF3NOS — CID 115854136
N-[(3-chlorothiophen-2-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine (PubChem CID 115854136) has the molecular formula C14H13ClF3NOS and a molecular weight of 335.78 g/mol. Its IUPAC name is N-[(3-chlorothiophen-2-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[(3-chlorothiophen-2-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 115854136 |
| Molecular Formula | C14H13ClF3NOS |
| Molecular Weight | 335.78 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | N-[(3-chlorothiophen-2-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine |
| SMILES | CCNC(c1cccc(OC(F)(F)F)c1)c1sccc1Cl |
| InChI | InChI=1S/C14H13ClF3NOS/c1-2-19-12(13-11(15)6-7-21-13)9-4-3-5-10(8-9)20-14(16,17)18/h3-8,12,19H,2H2,1H3 |
| InChIKey | OMFLEPYAXAZSLZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.78 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |