C13H14F3N3OS — CID 105145860
N-[(4-methylthiadiazol-5-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine (PubChem CID 105145860) has the molecular formula C13H14F3N3OS and a molecular weight of 317.34 g/mol. Its IUPAC name is N-[(4-methylthiadiazol-5-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[(4-methylthiadiazol-5-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 105145860 |
| Molecular Formula | C13H14F3N3OS |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-[(4-methylthiadiazol-5-yl)-[3-(trifluoromethoxy)phenyl]methyl]ethanamine |
| SMILES | CCNC(c1cccc(OC(F)(F)F)c1)c1snnc1C |
| InChI | InChI=1S/C13H14F3N3OS/c1-3-17-11(12-8(2)18-19-21-12)9-5-4-6-10(7-9)20-13(14,15)16/h4-7,11,17H,3H2,1-2H3 |
| InChIKey | GIGBQYROEQQDCK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |