C12H11BrClNO — CID 106857070
1-(2-bromofuran-3-yl)-1-(3-chlorophenyl)-N-methylmethanamine (PubChem CID 106857070) has the molecular formula C12H11BrClNO and a molecular weight of 300.58 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-1-(3-chlorophenyl)-N-methylmethanamine.
| Compound Name | 1-(2-bromofuran-3-yl)-1-(3-chlorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106857070 |
| Molecular Formula | C12H11BrClNO |
| Molecular Weight | 300.58 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-1-(3-chlorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cccc(Cl)c1)c1ccoc1Br |
| InChI | InChI=1S/C12H11BrClNO/c1-15-11(10-5-6-16-12(10)13)8-3-2-4-9(14)7-8/h2-7,11,15H,1H3 |
| InChIKey | SSWUQJSGBBMIEE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |