C16H18Cl2N2 — CID 166838557
(2R)-1,2-bis(3-chlorophenyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 166838557) has the molecular formula C16H18Cl2N2 and a molecular weight of 309.24 g/mol. Its IUPAC name is (2R)-1,2-bis(3-chlorophenyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | (2R)-1,2-bis(3-chlorophenyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 166838557 |
| Molecular Formula | C16H18Cl2N2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2R)-1,2-bis(3-chlorophenyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNC(c1cccc(Cl)c1)[C@H](NC)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2N2/c1-19-15(11-5-3-7-13(17)9-11)16(20-2)12-6-4-8-14(18)10-12/h3-10,15-16,19-20H,1-2H3/t15-,16?/m1/s1 |
| InChIKey | YQCWLPBCKFSOHE-AAFJCEBUSA-N |
| XLogP | 4.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |