C15H14F3NO — CID 62916540
N-methyl-1-phenyl-1-[3-(trifluoromethoxy)phenyl]methanamine (PubChem CID 62916540) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is N-methyl-1-phenyl-1-[3-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | N-methyl-1-phenyl-1-[3-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 62916540 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-methyl-1-phenyl-1-[3-(trifluoromethoxy)phenyl]methanamine |
| SMILES | CNC(c1ccccc1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F3NO/c1-19-14(11-6-3-2-4-7-11)12-8-5-9-13(10-12)20-15(16,17)18/h2-10,14,19H,1H3 |
| InChIKey | HRUYMQHNUCDPRL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |