C15H22F3NO2 — CID 116761004
2-ethyl-2-methoxy-N-methyl-1-[3-(trifluoromethoxy)phenyl]butan-1-amine (PubChem CID 116761004) has the molecular formula C15H22F3NO2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-ethyl-2-methoxy-N-methyl-1-[3-(trifluoromethoxy)phenyl]butan-1-amine.
| Compound Name | 2-ethyl-2-methoxy-N-methyl-1-[3-(trifluoromethoxy)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 116761004 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-ethyl-2-methoxy-N-methyl-1-[3-(trifluoromethoxy)phenyl]butan-1-amine |
| SMILES | CCC(CC)(OC)C(NC)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F3NO2/c1-5-14(6-2,20-4)13(19-3)11-8-7-9-12(10-11)21-15(16,17)18/h7-10,13,19H,5-6H2,1-4H3 |
| InChIKey | JHJPUFXADORZOT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |