C11H11Br2NOS — CID 106851847
1-(2-bromofuran-3-yl)-1-(5-bromo-2-methylthiophen-3-yl)-N-methylmethanamine (PubChem CID 106851847) has the molecular formula C11H11Br2NOS and a molecular weight of 365.09 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-1-(5-bromo-2-methylthiophen-3-yl)-N-methylmethanamine.
| Compound Name | 1-(2-bromofuran-3-yl)-1-(5-bromo-2-methylthiophen-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106851847 |
| Molecular Formula | C11H11Br2NOS |
| Molecular Weight | 365.09 g/mol |
| Exact Mass | 362.89 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-1-(5-bromo-2-methylthiophen-3-yl)-N-methylmethanamine |
| SMILES | CNC(c1ccoc1Br)c1cc(Br)sc1C |
| InChI | InChI=1S/C11H11Br2NOS/c1-6-8(5-9(12)16-6)10(14-2)7-3-4-15-11(7)13/h3-5,10,14H,1-2H3 |
| InChIKey | ACAIQKRELWOSLN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.09 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |