C13H11BrF3NS — CID 79749290
1-(5-bromo-2-methylthiophen-3-yl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine (PubChem CID 79749290) has the molecular formula C13H11BrF3NS and a molecular weight of 350.20 g/mol. Its IUPAC name is 1-(5-bromo-2-methylthiophen-3-yl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | 1-(5-bromo-2-methylthiophen-3-yl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 79749290 |
| Molecular Formula | C13H11BrF3NS |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 1-(5-bromo-2-methylthiophen-3-yl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine |
| SMILES | CNC(c1cc(Br)sc1C)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H11BrF3NS/c1-6-8(5-10(14)19-6)13(18-2)7-3-4-9(15)12(17)11(7)16/h3-5,13,18H,1-2H3 |
| InChIKey | IXZHQFJPFKLXPV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|