C16H13BrFNO — CID 106645563
1-(1-benzofuran-2-yl)-1-(3-bromo-2-fluorophenyl)-N-methylmethanamine (PubChem CID 106645563) has the molecular formula C16H13BrFNO and a molecular weight of 334.19 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-1-(3-bromo-2-fluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(1-benzofuran-2-yl)-1-(3-bromo-2-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106645563 |
| Molecular Formula | C16H13BrFNO |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-1-(3-bromo-2-fluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc2ccccc2o1)c1cccc(Br)c1F |
| InChI | InChI=1S/C16H13BrFNO/c1-19-16(11-6-4-7-12(17)15(11)18)14-9-10-5-2-3-8-13(10)20-14/h2-9,16,19H,1H3 |
| InChIKey | WIHFUBOBXRHKAY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |