C16H12BrF2NO — CID 107539018
1-(1-benzofuran-2-yl)-1-(2-bromo-3,4-difluorophenyl)-N-methylmethanamine (PubChem CID 107539018) has the molecular formula C16H12BrF2NO and a molecular weight of 352.18 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-1-(2-bromo-3,4-difluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(1-benzofuran-2-yl)-1-(2-bromo-3,4-difluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107539018 |
| Molecular Formula | C16H12BrF2NO |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-1-(2-bromo-3,4-difluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc2ccccc2o1)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C16H12BrF2NO/c1-20-16(10-6-7-11(18)15(19)14(10)17)13-8-9-4-2-3-5-12(9)21-13/h2-8,16,20H,1H3 |
| InChIKey | SRORJWHJNINBCC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|