C16H11Cl3F3NO4 — CID 141326573
methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate (PubChem CID 141326573) has the molecular formula C16H11Cl3F3NO4 and a molecular weight of 444.62 g/mol. Its IUPAC name is methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate.
| Compound Name | methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 141326573 |
| Molecular Formula | C16H11Cl3F3NO4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1ccc(Oc2nc(Cl)c(C(F)(F)F)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H11Cl3F3NO4/c1-7(15(24)25-2)26-8-3-5-9(6-4-8)27-14-12(18)11(17)10(13(19)23-14)16(20,21)22/h3-7H,1-2H3 |
| InChIKey | JMQZEJRCDQQPID-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|