About methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate
methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate (PubChem CID 141326573) has the molecular formula C16H11Cl3F3NO4
and a molecular weight of 444.62 g/mol. Its IUPAC name is methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate.
Molecular Properties
| Compound Name | methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| PubChem CID | 141326573 |
| Molecular Formula | C16H11Cl3F3NO4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1ccc(Oc2nc(Cl)c(C(F)(F)F)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H11Cl3F3NO4/c1-7(15(24)25-2)26-8-3-5-9(6-4-8)27-14-12(18)11(17)10(13(19)23-14)16(20,21)22/h3-7H,1-2H3 |
| InChIKey | JMQZEJRCDQQPID-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate?
The IUPAC name of methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate (CID 141326573) is methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate.
What is the SMILES notation for methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate?
The canonical SMILES for methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate is COC(=O)C(C)Oc1ccc(Oc2nc(Cl)c(C(F)(F)F)c(Cl)c2Cl)cc1.
What is the InChIKey of methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate?
The InChIKey is JMQZEJRCDQQPID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl3F3NO4/c1-7(15(24)25-2)26-8-3-5-9(6-4-8)27-14-12(18)11(17)10(13(19)23-14)16(20,21)22/h3-7H,1-2H3.
What are the key properties of methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate?
methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate has a molecular weight of 444.62 g/mol, XLogP of 5.79, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-[[3,4,6-trichloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate is sourced from PubChem (CID 141326573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).