C17H24ClNO5S — CID 71942674
2-(2-chlorophenoxy)-N-(1,1-dioxothiolan-3-yl)-N-(3-methoxypropyl)propanamide (PubChem CID 71942674) has the molecular formula C17H24ClNO5S and a molecular weight of 389.90 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-(1,1-dioxothiolan-3-yl)-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-(2-chlorophenoxy)-N-(1,1-dioxothiolan-3-yl)-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 71942674 |
| Molecular Formula | C17H24ClNO5S |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-(1,1-dioxothiolan-3-yl)-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCN(C(=O)C(C)Oc1ccccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24ClNO5S/c1-13(24-16-7-4-3-6-15(16)18)17(20)19(9-5-10-23-2)14-8-11-25(21,22)12-14/h3-4,6-7,13-14H,5,8-12H2,1-2H3 |
| InChIKey | UAEJXGUGJWSIJJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|