C15H20N2O6S — CID 26007694
(2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(2-nitrophenoxy)propanamide (PubChem CID 26007694) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(2-nitrophenoxy)propanamide.
| Compound Name | (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(2-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 26007694 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(2-nitrophenoxy)propanamide |
| SMILES | CCN(C(=O)[C@@H](C)Oc1ccccc1[N+](=O)[O-])[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20N2O6S/c1-3-16(12-8-9-24(21,22)10-12)15(18)11(2)23-14-7-5-4-6-13(14)17(19)20/h4-7,11-12H,3,8-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | YGLRJMQMYUFHGD-VXGBXAGGSA-N |
| XLogP | 1.40 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|