C17H22N2O8S — CID 26004596
[(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 4-methoxy-3-nitrobenzoate (PubChem CID 26004596) has the molecular formula C17H22N2O8S and a molecular weight of 414.44 g/mol. Its IUPAC name is [(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 4-methoxy-3-nitrobenzoate.
| Compound Name | [(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 26004596 |
| Molecular Formula | C17H22N2O8S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 4-methoxy-3-nitrobenzoate |
| SMILES | CCN(C(=O)[C@H](C)OC(=O)c1ccc(OC)c([N+](=O)[O-])c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22N2O8S/c1-4-18(13-7-8-28(24,25)10-13)16(20)11(2)27-17(21)12-5-6-15(26-3)14(9-12)19(22)23/h5-6,9,11,13H,4,7-8,10H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | XUYKMFMIFRIFJD-WCQYABFASA-N |
| XLogP | 1.18 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|