C18H20N2O7S2 — CID 46621423
[1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate (PubChem CID 46621423) has the molecular formula C18H20N2O7S2 and a molecular weight of 440.50 g/mol. Its IUPAC name is [1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | [1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46621423 |
| Molecular Formula | C18H20N2O7S2 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate |
| SMILES | CCN(C(=O)C(C)OC(=O)c1cc2cc([N+](=O)[O-])ccc2s1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H20N2O7S2/c1-3-19(14-6-7-29(25,26)10-14)17(21)11(2)27-18(22)16-9-12-8-13(20(23)24)4-5-15(12)28-16/h4-5,8-9,11,14H,3,6-7,10H2,1-2H3 |
| InChIKey | YZYSDHLMOWICRP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|