C24H25NO2S — CID 46233995
N-benzhydryl-4-(4-hydroxyphenyl)sulfanyl-N-methylbutanamide (PubChem CID 46233995) has the molecular formula C24H25NO2S and a molecular weight of 391.54 g/mol. Its IUPAC name is N-benzhydryl-4-(4-hydroxyphenyl)sulfanyl-N-methylbutanamide.
| Compound Name | N-benzhydryl-4-(4-hydroxyphenyl)sulfanyl-N-methylbutanamide |
|---|---|
| PubChem CID | 46233995 |
| Molecular Formula | C24H25NO2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-benzhydryl-4-(4-hydroxyphenyl)sulfanyl-N-methylbutanamide |
| SMILES | CN(C(=O)CCCSc1ccc(O)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO2S/c1-25(23(27)13-8-18-28-22-16-14-21(26)15-17-22)24(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-7,9-12,14-17,24,26H,8,13,18H2,1H3 |
| InChIKey | DNYBXGSUFNPYMK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|