C14H13BrN2O2S2 — CID 4808652
N'-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]thiophene-2-carbohydrazide (PubChem CID 4808652) has the molecular formula C14H13BrN2O2S2 and a molecular weight of 385.31 g/mol. Its IUPAC name is N'-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4808652 |
| Molecular Formula | C14H13BrN2O2S2 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | N'-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]thiophene-2-carbohydrazide |
| SMILES | Cc1cc(Br)ccc1SCC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H13BrN2O2S2/c1-9-7-10(15)4-5-11(9)21-8-13(18)16-17-14(19)12-3-2-6-20-12/h2-7H,8H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | IXWICCJZHIJYNR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|