C16H13BrN4O2S2 — CID 18268677
N'-[2-[1-(4-bromophenyl)imidazol-2-yl]sulfanylacetyl]thiophene-2-carbohydrazide (PubChem CID 18268677) has the molecular formula C16H13BrN4O2S2 and a molecular weight of 437.34 g/mol. Its IUPAC name is N'-[2-[1-(4-bromophenyl)imidazol-2-yl]sulfanylacetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[1-(4-bromophenyl)imidazol-2-yl]sulfanylacetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 18268677 |
| Molecular Formula | C16H13BrN4O2S2 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 435.97 |
| IUPAC Name | N'-[2-[1-(4-bromophenyl)imidazol-2-yl]sulfanylacetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CSc1nccn1-c1ccc(Br)cc1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C16H13BrN4O2S2/c17-11-3-5-12(6-4-11)21-8-7-18-16(21)25-10-14(22)19-20-15(23)13-2-1-9-24-13/h1-9H,10H2,(H,19,22)(H,20,23) |
| InChIKey | QWPAPDUZCWFOFP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|