C16H14N4O3S2 — CID 5199833
N'-[2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetyl]thiophene-2-carbohydrazide (PubChem CID 5199833) has the molecular formula C16H14N4O3S2 and a molecular weight of 374.45 g/mol. Its IUPAC name is N'-[2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 5199833 |
| Molecular Formula | C16H14N4O3S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | N'-[2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetyl]thiophene-2-carbohydrazide |
| SMILES | Cn1c(SCC(=O)NNC(=O)c2cccs2)nc2ccccc2c1=O |
| InChI | InChI=1S/C16H14N4O3S2/c1-20-15(23)10-5-2-3-6-11(10)17-16(20)25-9-13(21)18-19-14(22)12-7-4-8-24-12/h2-8H,9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | DAVRGAVWQXCQHI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|