C18H18BrN5O2S — CID 31421632
4-bromo-N'-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 31421632) has the molecular formula C18H18BrN5O2S and a molecular weight of 448.35 g/mol. Its IUPAC name is 4-bromo-N'-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31421632 |
| Molecular Formula | C18H18BrN5O2S |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 4-bromo-N'-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | Cc1cc(C)cc(-n2ccnc2SCC(=O)NNC(=O)c2cc(Br)c[nH]2)c1 |
| InChI | InChI=1S/C18H18BrN5O2S/c1-11-5-12(2)7-14(6-11)24-4-3-20-18(24)27-10-16(25)22-23-17(26)15-8-13(19)9-21-15/h3-9,21H,10H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | NLVNIICNQOJYII-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|