C21H22N4O2S — CID 51431650
N'-[2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanylacetyl]benzohydrazide (PubChem CID 51431650) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is N'-[2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanylacetyl]benzohydrazide.
| Compound Name | N'-[2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 51431650 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N'-[2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanylacetyl]benzohydrazide |
| SMILES | CC(C)c1ccc(-n2ccnc2SCC(=O)NNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N4O2S/c1-15(2)16-8-10-18(11-9-16)25-13-12-22-21(25)28-14-19(26)23-24-20(27)17-6-4-3-5-7-17/h3-13,15H,14H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | QGZAFLLTLRAODV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|