C20H23N3OS2 — CID 24578282
2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 24578282) has the molecular formula C20H23N3OS2 and a molecular weight of 385.56 g/mol. Its IUPAC name is 2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 24578282 |
| Molecular Formula | C20H23N3OS2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | CC(C)c1ccc(-n2ccnc2SCC(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C20H23N3OS2/c1-15(2)16-5-7-17(8-6-16)23-12-11-22-20(23)26-14-19(24)21-10-9-18-4-3-13-25-18/h3-8,11-13,15H,9-10,14H2,1-2H3,(H,21,24) |
| InChIKey | IHHPXJAYZRMGHO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |