C19H21N3O2S3 — CID 8002476
2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 8002476) has the molecular formula C19H21N3O2S3 and a molecular weight of 419.60 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8002476 |
| Molecular Formula | C19H21N3O2S3 |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | COc1ccc(-n2ccnc2SCC(=O)NCCSCc2cccs2)cc1 |
| InChI | InChI=1S/C19H21N3O2S3/c1-24-16-6-4-15(5-7-16)22-10-8-21-19(22)27-14-18(23)20-9-12-25-13-17-3-2-11-26-17/h2-8,10-11H,9,12-14H2,1H3,(H,20,23) |
| InChIKey | GVSCDKKGRTWFGB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|