C17H15ClN4O2S2 — CID 25406211
2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide (PubChem CID 25406211) has the molecular formula C17H15ClN4O2S2 and a molecular weight of 406.92 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 25406211 |
| Molecular Formula | C17H15ClN4O2S2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
| SMILES | O=C(CSc1nccn1-c1cccc(Cl)c1)NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C17H15ClN4O2S2/c18-12-3-1-4-13(9-12)22-7-6-19-17(22)26-11-15(23)21-16(24)20-10-14-5-2-8-25-14/h1-9H,10-11H2,(H2,20,21,23,24) |
| InChIKey | WEKZRYHJSPZMRA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |