C15H15BrN2O2S2 — CID 9479279
N'-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]thiophene-2-carbohydrazide (PubChem CID 9479279) has the molecular formula C15H15BrN2O2S2 and a molecular weight of 399.34 g/mol. Its IUPAC name is N'-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9479279 |
| Molecular Formula | C15H15BrN2O2S2 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | N'-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]thiophene-2-carbohydrazide |
| SMILES | Cc1cc(SCC(=O)NNC(=O)c2cccs2)c(C)cc1Br |
| InChI | InChI=1S/C15H15BrN2O2S2/c1-9-7-13(10(2)6-11(9)16)22-8-14(19)17-18-15(20)12-4-3-5-21-12/h3-7H,8H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | IQHPPIUREOBKOQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|