C19H21BrN2O2S — CID 38202282
N-[2-[[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]amino]ethyl]benzamide (PubChem CID 38202282) has the molecular formula C19H21BrN2O2S and a molecular weight of 421.36 g/mol. Its IUPAC name is N-[2-[[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 38202282 |
| Molecular Formula | C19H21BrN2O2S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | N-[2-[[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]amino]ethyl]benzamide |
| SMILES | Cc1cc(SCC(=O)NCCNC(=O)c2ccccc2)c(C)cc1Br |
| InChI | InChI=1S/C19H21BrN2O2S/c1-13-11-17(14(2)10-16(13)20)25-12-18(23)21-8-9-22-19(24)15-6-4-3-5-7-15/h3-7,10-11H,8-9,12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | HFNZQGIPDLKHPP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|