C14H21BrN2OS — CID 119496004
N-(3-aminobutyl)-2-(4-bromo-2,5-dimethylphenyl)sulfanylacetamide (PubChem CID 119496004) has the molecular formula C14H21BrN2OS and a molecular weight of 345.31 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-(4-bromo-2,5-dimethylphenyl)sulfanylacetamide.
| Compound Name | N-(3-aminobutyl)-2-(4-bromo-2,5-dimethylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 119496004 |
| Molecular Formula | C14H21BrN2OS |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-(3-aminobutyl)-2-(4-bromo-2,5-dimethylphenyl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)NCCC(C)N)c(C)cc1Br |
| InChI | InChI=1S/C14H21BrN2OS/c1-9-7-13(10(2)6-12(9)15)19-8-14(18)17-5-4-11(3)16/h6-7,11H,4-5,8,16H2,1-3H3,(H,17,18) |
| InChIKey | QJJHORXUJJFAJZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |