C18H24BrNO5S — CID 42963849
ethyl 4-[[2-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]oxyacetyl]amino]butanoate (PubChem CID 42963849) has the molecular formula C18H24BrNO5S and a molecular weight of 446.36 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]oxyacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]oxyacetyl]amino]butanoate |
|---|---|
| PubChem CID | 42963849 |
| Molecular Formula | C18H24BrNO5S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | ethyl 4-[[2-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]oxyacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)CSc1cc(C)c(Br)cc1C |
| InChI | InChI=1S/C18H24BrNO5S/c1-4-24-17(22)6-5-7-20-16(21)10-25-18(23)11-26-15-9-12(2)14(19)8-13(15)3/h8-9H,4-7,10-11H2,1-3H3,(H,20,21) |
| InChIKey | BHCJCHOYMGXJCM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|