C15H20BrNO4S — CID 2626406
[2-(2-methoxyethylamino)-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate (PubChem CID 2626406) has the molecular formula C15H20BrNO4S and a molecular weight of 390.30 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 2626406 |
| Molecular Formula | C15H20BrNO4S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate |
| SMILES | COCCNC(=O)COC(=O)CSc1cc(C)c(Br)cc1C |
| InChI | InChI=1S/C15H20BrNO4S/c1-10-7-13(11(2)6-12(10)16)22-9-15(19)21-8-14(18)17-4-5-20-3/h6-7H,4-5,8-9H2,1-3H3,(H,17,18) |
| InChIKey | ISVXPTXGSSXYCU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|