C15H15BrN2OS — CID 154775237
2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-pyridin-2-ylacetamide (PubChem CID 154775237) has the molecular formula C15H15BrN2OS and a molecular weight of 351.27 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-pyridin-2-ylacetamide.
| Compound Name | 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 154775237 |
| Molecular Formula | C15H15BrN2OS |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-pyridin-2-ylacetamide |
| SMILES | Cc1cc(SCC(=O)Nc2ccccn2)c(C)cc1Br |
| InChI | InChI=1S/C15H15BrN2OS/c1-10-8-13(11(2)7-12(10)16)20-9-15(19)18-14-5-3-4-6-17-14/h3-8H,9H2,1-2H3,(H,17,18,19) |
| InChIKey | WUVZXVIXPMNMNP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |