C15H14BrN3O3S2 — CID 3491325
2-(4-bromo-2-methylphenoxy)-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide (PubChem CID 3491325) has the molecular formula C15H14BrN3O3S2 and a molecular weight of 428.33 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenoxy)-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide.
| Compound Name | 2-(4-bromo-2-methylphenoxy)-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3491325 |
| Molecular Formula | C15H14BrN3O3S2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 2-(4-bromo-2-methylphenoxy)-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide |
| SMILES | Cc1cc(Br)ccc1OCC(=O)NC(=S)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C15H14BrN3O3S2/c1-9-7-10(16)4-5-11(9)22-8-13(20)17-15(23)19-18-14(21)12-3-2-6-24-12/h2-7H,8H2,1H3,(H,18,21)(H2,17,19,20,23) |
| InChIKey | ONTZXMWGBQCNAH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|