C14H12N4O5S2 — CID 3327759
2-(2-nitrophenoxy)-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide (PubChem CID 3327759) has the molecular formula C14H12N4O5S2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-(2-nitrophenoxy)-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide.
| Compound Name | 2-(2-nitrophenoxy)-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3327759 |
| Molecular Formula | C14H12N4O5S2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-(2-nitrophenoxy)-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])NC(=S)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H12N4O5S2/c19-12(8-23-10-5-2-1-4-9(10)18(21)22)15-14(24)17-16-13(20)11-6-3-7-25-11/h1-7H,8H2,(H,16,20)(H2,15,17,19,24) |
| InChIKey | BRHJZZGSSKJJCH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|