C15H12BrCl3N2OS — CID 5199553
2-(4-bromo-2-methylphenyl)sulfanyl-N'-(2,4,6-trichlorophenyl)acetohydrazide (PubChem CID 5199553) has the molecular formula C15H12BrCl3N2OS and a molecular weight of 454.60 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N'-(2,4,6-trichlorophenyl)acetohydrazide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N'-(2,4,6-trichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 5199553 |
| Molecular Formula | C15H12BrCl3N2OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 451.89 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N'-(2,4,6-trichlorophenyl)acetohydrazide |
| SMILES | Cc1cc(Br)ccc1SCC(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12BrCl3N2OS/c1-8-4-9(16)2-3-13(8)23-7-14(22)20-21-15-11(18)5-10(17)6-12(15)19/h2-6,21H,7H2,1H3,(H,20,22) |
| InChIKey | JSYCNQKGIJNZGY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|