C14H12N4OS2 — CID 55631629
3-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide (PubChem CID 55631629) has the molecular formula C14H12N4OS2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 3-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide.
| Compound Name | 3-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 55631629 |
| Molecular Formula | C14H12N4OS2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 3-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide |
| SMILES | NC(=O)c1cccc(CSc2n[nH]c(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C14H12N4OS2/c15-12(19)10-4-1-3-9(7-10)8-21-14-16-13(17-18-14)11-5-2-6-20-11/h1-7H,8H2,(H2,15,19)(H,16,17,18) |
| InChIKey | WZZNWQIHVQIRPE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |