C16H15ClN4S — CID 31047768
2-chloro-5-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine (PubChem CID 31047768) has the molecular formula C16H15ClN4S and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-chloro-5-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine.
| Compound Name | 2-chloro-5-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 31047768 |
| Molecular Formula | C16H15ClN4S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-chloro-5-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine |
| SMILES | Cc1ccc(-c2nnc(SCc3ccc(Cl)nc3)n2C)cc1 |
| InChI | InChI=1S/C16H15ClN4S/c1-11-3-6-13(7-4-11)15-19-20-16(21(15)2)22-10-12-5-8-14(17)18-9-12/h3-9H,10H2,1-2H3 |
| InChIKey | XNWMXWXNRPBJFV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|