C21H16Cl2N4S — CID 18268699
2-chloro-5-[[5-(4-chlorophenyl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine (PubChem CID 18268699) has the molecular formula C21H16Cl2N4S and a molecular weight of 427.36 g/mol. Its IUPAC name is 2-chloro-5-[[5-(4-chlorophenyl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine.
| Compound Name | 2-chloro-5-[[5-(4-chlorophenyl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 18268699 |
| Molecular Formula | C21H16Cl2N4S |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 2-chloro-5-[[5-(4-chlorophenyl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine |
| SMILES | Cc1ccccc1-n1c(SCc2ccc(Cl)nc2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16Cl2N4S/c1-14-4-2-3-5-18(14)27-20(16-7-9-17(22)10-8-16)25-26-21(27)28-13-15-6-11-19(23)24-12-15/h2-12H,13H2,1H3 |
| InChIKey | VZDVENJTYJXJLC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|