C15H14ClN5S — CID 38862897
2-chloro-5-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine (PubChem CID 38862897) has the molecular formula C15H14ClN5S and a molecular weight of 331.83 g/mol. Its IUPAC name is 2-chloro-5-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine.
| Compound Name | 2-chloro-5-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 38862897 |
| Molecular Formula | C15H14ClN5S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-chloro-5-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine |
| SMILES | CCn1c(SCc2ccc(Cl)nc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C15H14ClN5S/c1-2-21-14(12-5-7-17-8-6-12)19-20-15(21)22-10-11-3-4-13(16)18-9-11/h3-9H,2,10H2,1H3 |
| InChIKey | IXZSHIURFJQPHR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|