C20H24ClN5S — CID 55525009
4-[5-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]-N,N-diethylaniline (PubChem CID 55525009) has the molecular formula C20H24ClN5S and a molecular weight of 401.97 g/mol. Its IUPAC name is 4-[5-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]-N,N-diethylaniline.
| Compound Name | 4-[5-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 55525009 |
| Molecular Formula | C20H24ClN5S |
| Molecular Weight | 401.97 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[5-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-c2nnc(SCc3ccc(Cl)nc3)n2CC)cc1 |
| InChI | InChI=1S/C20H24ClN5S/c1-4-25(5-2)17-10-8-16(9-11-17)19-23-24-20(26(19)6-3)27-14-15-7-12-18(21)22-13-15/h7-13H,4-6,14H2,1-3H3 |
| InChIKey | URJSOSBWZCIFNP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.97 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|