C22H29N5OS — CID 86901088
N,N-diethyl-4-[4-ethyl-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)-1,2,4-triazol-3-yl]aniline (PubChem CID 86901088) has the molecular formula C22H29N5OS and a molecular weight of 411.58 g/mol. Its IUPAC name is N,N-diethyl-4-[4-ethyl-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)-1,2,4-triazol-3-yl]aniline.
| Compound Name | N,N-diethyl-4-[4-ethyl-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 86901088 |
| Molecular Formula | C22H29N5OS |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N,N-diethyl-4-[4-ethyl-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)-1,2,4-triazol-3-yl]aniline |
| SMILES | CCN(CC)c1ccc(-c2nnc(SCc3noc4c3CCCC4)n2CC)cc1 |
| InChI | InChI=1S/C22H29N5OS/c1-4-26(5-2)17-13-11-16(12-14-17)21-23-24-22(27(21)6-3)29-15-19-18-9-7-8-10-20(18)28-25-19/h11-14H,4-10,15H2,1-3H3 |
| InChIKey | NQZBPSRABSCETE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |