C21H26N4OS — CID 86901073
3-[[5-(4-tert-butylphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole (PubChem CID 86901073) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is 3-[[5-(4-tert-butylphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole.
| Compound Name | 3-[[5-(4-tert-butylphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 86901073 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-[[5-(4-tert-butylphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole |
| SMILES | Cn1c(SCc2noc3c2CCCC3)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H26N4OS/c1-21(2,3)15-11-9-14(10-12-15)19-22-23-20(25(19)4)27-13-17-16-7-5-6-8-18(16)26-24-17/h9-12H,5-8,13H2,1-4H3 |
| InChIKey | RYYCFNWGGKSXAT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |