C12H12ClN3S — CID 60716308
2-[(6-chloro-3-pyridinyl)methylsulfanyl]-4,6-dimethylpyrimidine (PubChem CID 60716308) has the molecular formula C12H12ClN3S and a molecular weight of 265.77 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 60716308 |
| Molecular Formula | C12H12ClN3S |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(SCc2ccc(Cl)nc2)n1 |
| InChI | InChI=1S/C12H12ClN3S/c1-8-5-9(2)16-12(15-8)17-7-10-3-4-11(13)14-6-10/h3-6H,7H2,1-2H3 |
| InChIKey | PWSOULKZGOIQIN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|