C15H17ClN2S2 — CID 5002015
2-[2-[(4-chlorophenyl)methylsulfanyl]ethylsulfanyl]-4,6-dimethylpyrimidine (PubChem CID 5002015) has the molecular formula C15H17ClN2S2 and a molecular weight of 324.90 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenyl)methylsulfanyl]ethylsulfanyl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[2-[(4-chlorophenyl)methylsulfanyl]ethylsulfanyl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 5002015 |
| Molecular Formula | C15H17ClN2S2 |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-[2-[(4-chlorophenyl)methylsulfanyl]ethylsulfanyl]-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(SCCSCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H17ClN2S2/c1-11-9-12(2)18-15(17-11)20-8-7-19-10-13-3-5-14(16)6-4-13/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | BOZJPNWFDKULSY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|