C14H14ClN3OS — CID 914061
4-chloro-N-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide (PubChem CID 914061) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 4-chloro-N-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide.
| Compound Name | 4-chloro-N-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 914061 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-chloro-N-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide |
| SMILES | Cc1cc(C)nc(SCNC(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H14ClN3OS/c1-9-7-10(2)18-14(17-9)20-8-16-13(19)11-3-5-12(15)6-4-11/h3-7H,8H2,1-2H3,(H,16,19) |
| InChIKey | HTHCOFLGFRGATA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|