C15H15ClN4S2 — CID 18708381
2-[(5-tert-butyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-chloro-1,3-thiazole (PubChem CID 18708381) has the molecular formula C15H15ClN4S2 and a molecular weight of 350.90 g/mol. Its IUPAC name is 2-[(5-tert-butyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-chloro-1,3-thiazole.
| Compound Name | 2-[(5-tert-butyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-chloro-1,3-thiazole |
|---|---|
| PubChem CID | 18708381 |
| Molecular Formula | C15H15ClN4S2 |
| Molecular Weight | 350.90 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 2-[(5-tert-butyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-chloro-1,3-thiazole |
| SMILES | CC(C)(C)c1nnc(Sc2ncc(Cl)s2)n1-c1ccccc1 |
| InChI | InChI=1S/C15H15ClN4S2/c1-15(2,3)12-18-19-13(22-14-17-9-11(16)21-14)20(12)10-7-5-4-6-8-10/h4-9H,1-3H3 |
| InChIKey | NHKGDVUVOHBKIN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|